C17H23N5O5S2 — CID 156697519
N-[2-[[3-[4-(hydroxymethyl)-3-nitroanilino]-3-oxopropyl]disulfanyl]ethyl]-3-(3-methyldiazirin-3-yl)propanamide (PubChem CID 156697519) has the molecular formula C17H23N5O5S2 and a molecular weight of 441.54 g/mol. Its IUPAC name is N-[2-[[3-[4-(hydroxymethyl)-3-nitroanilino]-3-oxopropyl]disulfanyl]ethyl]-3-(3-methyldiazirin-3-yl)propanamide.
| Compound Name | N-[2-[[3-[4-(hydroxymethyl)-3-nitroanilino]-3-oxopropyl]disulfanyl]ethyl]-3-(3-methyldiazirin-3-yl)propanamide |
|---|---|
| PubChem CID | 156697519 |
| Molecular Formula | C17H23N5O5S2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-[2-[[3-[4-(hydroxymethyl)-3-nitroanilino]-3-oxopropyl]disulfanyl]ethyl]-3-(3-methyldiazirin-3-yl)propanamide |
| SMILES | CC1(CCC(=O)NCCSSCCC(=O)Nc2ccc(CO)c([N+](=O)[O-])c2)N=N1 |
| InChI | InChI=1S/C17H23N5O5S2/c1-17(20-21-17)6-4-15(24)18-7-9-29-28-8-5-16(25)19-13-3-2-12(11-23)14(10-13)22(26)27/h2-3,10,23H,4-9,11H2,1H3,(H,18,24)(H,19,25) |
| InChIKey | GBTMYPPGKMUOIR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|