C16H21N3O8S2 — CID 175492901
1,3,2-dioxazolidin-2-yl 3-[[3-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-3-oxopropyl]disulfanyl]propanoate (PubChem CID 175492901) has the molecular formula C16H21N3O8S2 and a molecular weight of 447.49 g/mol. Its IUPAC name is 1,3,2-dioxazolidin-2-yl 3-[[3-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | 1,3,2-dioxazolidin-2-yl 3-[[3-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 175492901 |
| Molecular Formula | C16H21N3O8S2 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 1,3,2-dioxazolidin-2-yl 3-[[3-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-3-oxopropyl]disulfanyl]propanoate |
| SMILES | O=C(CCSSCCC(=O)ON1OCCO1)NCc1ccc(CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N3O8S2/c20-11-13-2-1-12(9-14(13)18(23)24)10-17-15(21)3-7-28-29-8-4-16(22)27-19-25-5-6-26-19/h1-2,9,20H,3-8,10-11H2,(H,17,21) |
| InChIKey | AONNEAFOLXQBTK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|