C16H20N2O9S2 — CID 175492910
[4-(hydroxymethyl)-3-nitrophenyl]methyl 3-[[3-(1,3,2-dioxazolidin-2-yloxy)-3-oxopropyl]disulfanyl]propanoate (PubChem CID 175492910) has the molecular formula C16H20N2O9S2 and a molecular weight of 448.48 g/mol. Its IUPAC name is [4-(hydroxymethyl)-3-nitrophenyl]methyl 3-[[3-(1,3,2-dioxazolidin-2-yloxy)-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | [4-(hydroxymethyl)-3-nitrophenyl]methyl 3-[[3-(1,3,2-dioxazolidin-2-yloxy)-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 175492910 |
| Molecular Formula | C16H20N2O9S2 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | [4-(hydroxymethyl)-3-nitrophenyl]methyl 3-[[3-(1,3,2-dioxazolidin-2-yloxy)-3-oxopropyl]disulfanyl]propanoate |
| SMILES | O=C(CCSSCCC(=O)ON1OCCO1)OCc1ccc(CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N2O9S2/c19-10-13-2-1-12(9-14(13)17(22)23)11-24-15(20)3-7-28-29-8-4-16(21)27-18-25-5-6-26-18/h1-2,9,19H,3-8,10-11H2 |
| InChIKey | XIUPRSAXXJYNOX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|