C15H18N2O8 — CID 91718095
1-O-ethyl 5-O-[(4-methyl-3,5-dinitrophenyl)methyl] pentanedioate (PubChem CID 91718095) has the molecular formula C15H18N2O8 and a molecular weight of 354.32 g/mol. Its IUPAC name is 1-O-ethyl 5-O-[(4-methyl-3,5-dinitrophenyl)methyl] pentanedioate.
| Compound Name | 1-O-ethyl 5-O-[(4-methyl-3,5-dinitrophenyl)methyl] pentanedioate |
|---|---|
| PubChem CID | 91718095 |
| Molecular Formula | C15H18N2O8 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-O-ethyl 5-O-[(4-methyl-3,5-dinitrophenyl)methyl] pentanedioate |
| SMILES | CCOC(=O)CCCC(=O)OCc1cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N2O8/c1-3-24-14(18)5-4-6-15(19)25-9-11-7-12(16(20)21)10(2)13(8-11)17(22)23/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | OVSANYFZAWXWOR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|