C16H18N2O4S — CID 142479118
ethyl 4-[2-nitro-4-(1,3-thiazol-2-ylmethyl)phenyl]butanoate (PubChem CID 142479118) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is ethyl 4-[2-nitro-4-(1,3-thiazol-2-ylmethyl)phenyl]butanoate.
| Compound Name | ethyl 4-[2-nitro-4-(1,3-thiazol-2-ylmethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 142479118 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | ethyl 4-[2-nitro-4-(1,3-thiazol-2-ylmethyl)phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(Cc2nccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N2O4S/c1-2-22-16(19)5-3-4-13-7-6-12(10-14(13)18(20)21)11-15-17-8-9-23-15/h6-10H,2-5,11H2,1H3 |
| InChIKey | HNZRGZXAGFNONH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|