C18H16N4O12 — CID 173386473
2-(2,4-dinitrophenyl)acetic acid;ethyl 2-(2,4-dinitrophenyl)acetate (PubChem CID 173386473) has the molecular formula C18H16N4O12 and a molecular weight of 480.34 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)acetic acid;ethyl 2-(2,4-dinitrophenyl)acetate.
| Compound Name | 2-(2,4-dinitrophenyl)acetic acid;ethyl 2-(2,4-dinitrophenyl)acetate |
|---|---|
| PubChem CID | 173386473 |
| Molecular Formula | C18H16N4O12 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2-(2,4-dinitrophenyl)acetic acid;ethyl 2-(2,4-dinitrophenyl)acetate |
| SMILES | CCOC(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].O=C(O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O6.C8H6N2O6/c1-2-18-10(13)5-7-3-4-8(11(14)15)6-9(7)12(16)17;11-8(12)3-5-1-2-6(9(13)14)4-7(5)10(15)16/h3-4,6H,2,5H2,1H3;1-2,4H,3H2,(H,11,12) |
| InChIKey | ODMYQOISMCXFIP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 236.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|