C13H12N4O7 — CID 125451206
ethyl 2-[2-(2,4-dinitrophenyl)-3-oxo-1H-pyrazol-4-yl]acetate (PubChem CID 125451206) has the molecular formula C13H12N4O7 and a molecular weight of 336.26 g/mol. Its IUPAC name is ethyl 2-[2-(2,4-dinitrophenyl)-3-oxo-1H-pyrazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(2,4-dinitrophenyl)-3-oxo-1H-pyrazol-4-yl]acetate |
|---|---|
| PubChem CID | 125451206 |
| Molecular Formula | C13H12N4O7 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | ethyl 2-[2-(2,4-dinitrophenyl)-3-oxo-1H-pyrazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1c[nH]n(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C13H12N4O7/c1-2-24-12(18)5-8-7-14-15(13(8)19)10-4-3-9(16(20)21)6-11(10)17(22)23/h3-4,6-7,14H,2,5H2,1H3 |
| InChIKey | AFMKKRDEQMSRIU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 150.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|