C24H16N10O12 — CID 5211636
diethyl 4,12-bis(2,4-dinitrophenyl)-2,4,5,8,11,12-hexazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene-6,10-dicarboxylate (PubChem CID 5211636) has the molecular formula C24H16N10O12 and a molecular weight of 636.45 g/mol. Its IUPAC name is diethyl 4,12-bis(2,4-dinitrophenyl)-2,4,5,8,11,12-hexazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene-6,10-dicarboxylate.
| Compound Name | diethyl 4,12-bis(2,4-dinitrophenyl)-2,4,5,8,11,12-hexazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene-6,10-dicarboxylate |
|---|---|
| PubChem CID | 5211636 |
| Molecular Formula | C24H16N10O12 |
| Molecular Weight | 636.45 g/mol |
| Exact Mass | 636.09 |
| IUPAC Name | diethyl 4,12-bis(2,4-dinitrophenyl)-2,4,5,8,11,12-hexazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene-6,10-dicarboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2nc3c(nc12)c(C(=O)OCC)nn3-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16N10O12/c1-3-45-23(35)19-17-21(29(27-19)13-7-5-11(31(37)38)9-15(13)33(41)42)26-22-18(25-17)20(24(36)46-4-2)28-30(22)14-8-6-12(32(39)40)10-16(14)34(43)44/h5-10H,3-4H2,1-2H3 |
| InChIKey | PLJMDZTXMCMIBV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 286.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|