C13H12N4O6 — CID 25220454
ethyl 1-(2,4-dinitrophenyl)-5-methylpyrazole-4-carboxylate (PubChem CID 25220454) has the molecular formula C13H12N4O6 and a molecular weight of 320.26 g/mol. Its IUPAC name is ethyl 1-(2,4-dinitrophenyl)-5-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-(2,4-dinitrophenyl)-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 25220454 |
| Molecular Formula | C13H12N4O6 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | ethyl 1-(2,4-dinitrophenyl)-5-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H12N4O6/c1-3-23-13(18)10-7-14-15(8(10)2)11-5-4-9(16(19)20)6-12(11)17(21)22/h4-7H,3H2,1-2H3 |
| InChIKey | PNUVLRMIULXKSX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|