C14H16N2O4S — CID 22267610
ethyl 5-methyl-1-(4-methylsulfonylphenyl)pyrazole-4-carboxylate (PubChem CID 22267610) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is ethyl 5-methyl-1-(4-methylsulfonylphenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-(4-methylsulfonylphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22267610 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | ethyl 5-methyl-1-(4-methylsulfonylphenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(S(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C14H16N2O4S/c1-4-20-14(17)13-9-15-16(10(13)2)11-5-7-12(8-6-11)21(3,18)19/h5-9H,4H2,1-3H3 |
| InChIKey | ZBYQNVKGIJFDCZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |