C15H19N3O7S2 — CID 10526009
ethyl 5-[bis(methylsulfonyl)amino]-1-(4-methoxyphenyl)pyrazole-4-carboxylate (PubChem CID 10526009) has the molecular formula C15H19N3O7S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is ethyl 5-[bis(methylsulfonyl)amino]-1-(4-methoxyphenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[bis(methylsulfonyl)amino]-1-(4-methoxyphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 10526009 |
| Molecular Formula | C15H19N3O7S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | ethyl 5-[bis(methylsulfonyl)amino]-1-(4-methoxyphenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(OC)cc2)c1N(S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C15H19N3O7S2/c1-5-25-15(19)13-10-16-17(11-6-8-12(24-2)9-7-11)14(13)18(26(3,20)21)27(4,22)23/h6-10H,5H2,1-4H3 |
| InChIKey | NKJQYLQQLNZQHK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 124.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |