C23H25N5O5 — CID 55652008
ethyl 1-[4-[[[2-(4-methoxyanilino)acetyl]amino]carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate (PubChem CID 55652008) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is ethyl 1-[4-[[[2-(4-methoxyanilino)acetyl]amino]carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-[[[2-(4-methoxyanilino)acetyl]amino]carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55652008 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | ethyl 1-[4-[[[2-(4-methoxyanilino)acetyl]amino]carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)NNC(=O)CNc3ccc(OC)cc3)cc2)c1C |
| InChI | InChI=1S/C23H25N5O5/c1-4-33-23(31)20-13-25-28(15(20)2)18-9-5-16(6-10-18)22(30)27-26-21(29)14-24-17-7-11-19(32-3)12-8-17/h5-13,24H,4,14H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | VJRCMNHSUGHIBW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|