C20H27N3O4 — CID 71849193
ethyl 1-[4-[(2-hydroxy-4-methylpentyl)carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate (PubChem CID 71849193) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethyl 1-[4-[(2-hydroxy-4-methylpentyl)carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-[(2-hydroxy-4-methylpentyl)carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71849193 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | ethyl 1-[4-[(2-hydroxy-4-methylpentyl)carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)NCC(O)CC(C)C)cc2)c1C |
| InChI | InChI=1S/C20H27N3O4/c1-5-27-20(26)18-12-22-23(14(18)4)16-8-6-15(7-9-16)19(25)21-11-17(24)10-13(2)3/h6-9,12-13,17,24H,5,10-11H2,1-4H3,(H,21,25) |
| InChIKey | JBCUDOQCIKBTGP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |