C23H24N4O6 — CID 43070191
ethyl 1-[4-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate (PubChem CID 43070191) has the molecular formula C23H24N4O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is ethyl 1-[4-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 43070191 |
| Molecular Formula | C23H24N4O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | ethyl 1-[4-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]phenyl]-5-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)NNC(=O)c3ccc(OC)c(OC)c3)cc2)c1C |
| InChI | InChI=1S/C23H24N4O6/c1-5-33-23(30)18-13-24-27(14(18)2)17-9-6-15(7-10-17)21(28)25-26-22(29)16-8-11-19(31-3)20(12-16)32-4/h6-13H,5H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | SQXYTLXVAXYGKW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|