C23H25FN4O4 — CID 46587133
N'-(4-butoxy-3-methoxybenzoyl)-1-(4-fluorophenyl)-5-methylpyrazole-4-carbohydrazide (PubChem CID 46587133) has the molecular formula C23H25FN4O4 and a molecular weight of 440.48 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-1-(4-fluorophenyl)-5-methylpyrazole-4-carbohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-1-(4-fluorophenyl)-5-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46587133 |
| Molecular Formula | C23H25FN4O4 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-1-(4-fluorophenyl)-5-methylpyrazole-4-carbohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2cnn(-c3ccc(F)cc3)c2C)cc1OC |
| InChI | InChI=1S/C23H25FN4O4/c1-4-5-12-32-20-11-6-16(13-21(20)31-3)22(29)26-27-23(30)19-14-25-28(15(19)2)18-9-7-17(24)8-10-18/h6-11,13-14H,4-5,12H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | VRORAOCGXBXKHR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|