C23H25ClN4O4 — CID 46671387
1-(4-chlorophenyl)-N'-(4-ethoxy-3-methoxybenzoyl)-5-propan-2-ylpyrazole-4-carbohydrazide (PubChem CID 46671387) has the molecular formula C23H25ClN4O4 and a molecular weight of 456.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N'-(4-ethoxy-3-methoxybenzoyl)-5-propan-2-ylpyrazole-4-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)-N'-(4-ethoxy-3-methoxybenzoyl)-5-propan-2-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46671387 |
| Molecular Formula | C23H25ClN4O4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N'-(4-ethoxy-3-methoxybenzoyl)-5-propan-2-ylpyrazole-4-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2cnn(-c3ccc(Cl)cc3)c2C(C)C)cc1OC |
| InChI | InChI=1S/C23H25ClN4O4/c1-5-32-19-11-6-15(12-20(19)31-4)22(29)26-27-23(30)18-13-25-28(21(18)14(2)3)17-9-7-16(24)8-10-17/h6-14H,5H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | LWGISVLDMIGUTJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|