C23H25ClN4O5 — CID 43058699
1-(3-chlorophenyl)-5-propan-2-yl-N'-(3,4,5-trimethoxybenzoyl)pyrazole-4-carbohydrazide (PubChem CID 43058699) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-propan-2-yl-N'-(3,4,5-trimethoxybenzoyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-(3-chlorophenyl)-5-propan-2-yl-N'-(3,4,5-trimethoxybenzoyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 43058699 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-(3-chlorophenyl)-5-propan-2-yl-N'-(3,4,5-trimethoxybenzoyl)pyrazole-4-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cnn(-c3cccc(Cl)c3)c2C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C23H25ClN4O5/c1-13(2)20-17(12-25-28(20)16-8-6-7-15(24)11-16)23(30)27-26-22(29)14-9-18(31-3)21(33-5)19(10-14)32-4/h6-13H,1-5H3,(H,26,29)(H,27,30) |
| InChIKey | VUJLTFFPKMFCNB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|