C21H19ClN8O2 — CID 46587147
1-(3-chlorophenyl)-5-propan-2-yl-N'-[4-(tetrazol-1-yl)benzoyl]pyrazole-4-carbohydrazide (PubChem CID 46587147) has the molecular formula C21H19ClN8O2 and a molecular weight of 450.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-propan-2-yl-N'-[4-(tetrazol-1-yl)benzoyl]pyrazole-4-carbohydrazide.
| Compound Name | 1-(3-chlorophenyl)-5-propan-2-yl-N'-[4-(tetrazol-1-yl)benzoyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46587147 |
| Molecular Formula | C21H19ClN8O2 |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 1-(3-chlorophenyl)-5-propan-2-yl-N'-[4-(tetrazol-1-yl)benzoyl]pyrazole-4-carbohydrazide |
| SMILES | CC(C)c1c(C(=O)NNC(=O)c2ccc(-n3cnnn3)cc2)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19ClN8O2/c1-13(2)19-18(11-24-30(19)17-5-3-4-15(22)10-17)21(32)26-25-20(31)14-6-8-16(9-7-14)29-12-23-27-28-29/h3-13H,1-2H3,(H,25,31)(H,26,32) |
| InChIKey | LLQPEFNMUCJEKG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|