C24H25FN2O6 — CID 46656743
N'-(4-butoxy-3-methoxybenzoyl)-5-[(4-fluorophenoxy)methyl]furan-2-carbohydrazide (PubChem CID 46656743) has the molecular formula C24H25FN2O6 and a molecular weight of 456.47 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-5-[(4-fluorophenoxy)methyl]furan-2-carbohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-5-[(4-fluorophenoxy)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 46656743 |
| Molecular Formula | C24H25FN2O6 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-5-[(4-fluorophenoxy)methyl]furan-2-carbohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2ccc(COc3ccc(F)cc3)o2)cc1OC |
| InChI | InChI=1S/C24H25FN2O6/c1-3-4-13-31-20-11-5-16(14-22(20)30-2)23(28)26-27-24(29)21-12-10-19(33-21)15-32-18-8-6-17(25)7-9-18/h5-12,14H,3-4,13,15H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | HHSMWHXBKUCOCZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|