C13H14N2O3 — CID 86692424
ethyl 1-(4-hydroxyphenyl)-5-methylpyrazole-4-carboxylate (PubChem CID 86692424) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is ethyl 1-(4-hydroxyphenyl)-5-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-(4-hydroxyphenyl)-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 86692424 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | ethyl 1-(4-hydroxyphenyl)-5-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(O)cc2)c1C |
| InChI | InChI=1S/C13H14N2O3/c1-3-18-13(17)12-8-14-15(9(12)2)10-4-6-11(16)7-5-10/h4-8,16H,3H2,1-2H3 |
| InChIKey | ILQODNNKVQGFOT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |