C21H22N4O3 — CID 46429346
ethyl 5-methyl-1-[4-(2-pyridin-2-ylethylcarbamoyl)phenyl]pyrazole-4-carboxylate (PubChem CID 46429346) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 5-methyl-1-[4-(2-pyridin-2-ylethylcarbamoyl)phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-[4-(2-pyridin-2-ylethylcarbamoyl)phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 46429346 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl 5-methyl-1-[4-(2-pyridin-2-ylethylcarbamoyl)phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)NCCc3ccccn3)cc2)c1C |
| InChI | InChI=1S/C21H22N4O3/c1-3-28-21(27)19-14-24-25(15(19)2)18-9-7-16(8-10-18)20(26)23-13-11-17-6-4-5-12-22-17/h4-10,12,14H,3,11,13H2,1-2H3,(H,23,26) |
| InChIKey | WWAVATVLBYVHOT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |