C28H35N5O3 — CID 55860992
ethyl 5-methyl-1-[4-[4-(4-phenylpiperazin-1-yl)butylcarbamoyl]phenyl]pyrazole-4-carboxylate (PubChem CID 55860992) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is ethyl 5-methyl-1-[4-[4-(4-phenylpiperazin-1-yl)butylcarbamoyl]phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-[4-[4-(4-phenylpiperazin-1-yl)butylcarbamoyl]phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55860992 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | ethyl 5-methyl-1-[4-[4-(4-phenylpiperazin-1-yl)butylcarbamoyl]phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)NCCCCN3CCN(c4ccccc4)CC3)cc2)c1C |
| InChI | InChI=1S/C28H35N5O3/c1-3-36-28(35)26-21-30-33(22(26)2)25-13-11-23(12-14-25)27(34)29-15-7-8-16-31-17-19-32(20-18-31)24-9-5-4-6-10-24/h4-6,9-14,21H,3,7-8,15-20H2,1-2H3,(H,29,34) |
| InChIKey | HFBZVQIHMJPBBX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|