C15H19N3O5S — CID 10570059
ethyl 1-(4-methoxyphenyl)-5-[methyl(methylsulfonyl)amino]pyrazole-4-carboxylate (PubChem CID 10570059) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is ethyl 1-(4-methoxyphenyl)-5-[methyl(methylsulfonyl)amino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(4-methoxyphenyl)-5-[methyl(methylsulfonyl)amino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 10570059 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | ethyl 1-(4-methoxyphenyl)-5-[methyl(methylsulfonyl)amino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(OC)cc2)c1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C15H19N3O5S/c1-5-23-15(19)13-10-16-18(14(13)17(2)24(4,20)21)11-6-8-12(22-3)9-7-11/h6-10H,5H2,1-4H3 |
| InChIKey | XQIUQKUJEAKTSF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |