C19H19N3O5S — CID 5065328
ethyl 5-[(4-methoxyphenyl)sulfonylamino]-1-phenylpyrazole-4-carboxylate (PubChem CID 5065328) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is ethyl 5-[(4-methoxyphenyl)sulfonylamino]-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(4-methoxyphenyl)sulfonylamino]-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 5065328 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | ethyl 5-[(4-methoxyphenyl)sulfonylamino]-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H19N3O5S/c1-3-27-19(23)17-13-20-22(14-7-5-4-6-8-14)18(17)21-28(24,25)16-11-9-15(26-2)10-12-16/h4-13,21H,3H2,1-2H3 |
| InChIKey | LASGDYHUIBDVLJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |