C12H13N3O5S — CID 21251119
5-[(4-methoxyphenyl)sulfonylamino]-1-methylpyrazole-4-carboxylic acid (PubChem CID 21251119) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)sulfonylamino]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[(4-methoxyphenyl)sulfonylamino]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 21251119 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 5-[(4-methoxyphenyl)sulfonylamino]-1-methylpyrazole-4-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2c(C(=O)O)cnn2C)cc1 |
| InChI | InChI=1S/C12H13N3O5S/c1-15-11(10(7-13-15)12(16)17)14-21(18,19)9-5-3-8(20-2)4-6-9/h3-7,14H,1-2H3,(H,16,17) |
| InChIKey | WKHKJADJRBKMQP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |