C9H11N5O4S — CID 113443879
1-methyl-5-[(2-methylpyrazol-3-yl)sulfonylamino]pyrazole-4-carboxylic acid (PubChem CID 113443879) has the molecular formula C9H11N5O4S and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-methyl-5-[(2-methylpyrazol-3-yl)sulfonylamino]pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-5-[(2-methylpyrazol-3-yl)sulfonylamino]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113443879 |
| Molecular Formula | C9H11N5O4S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 1-methyl-5-[(2-methylpyrazol-3-yl)sulfonylamino]pyrazole-4-carboxylic acid |
| SMILES | Cn1nccc1S(=O)(=O)Nc1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C9H11N5O4S/c1-13-7(3-4-10-13)19(17,18)12-8-6(9(15)16)5-11-14(8)2/h3-5,12H,1-2H3,(H,15,16) |
| InChIKey | IMWZOYVSPFVRDT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |