C10H12N4O4S — CID 113483146
5-methyl-3-[(2-methylpyrazol-3-yl)sulfonylamino]-1H-pyrrole-2-carboxylic acid (PubChem CID 113483146) has the molecular formula C10H12N4O4S and a molecular weight of 284.30 g/mol. Its IUPAC name is 5-methyl-3-[(2-methylpyrazol-3-yl)sulfonylamino]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-methyl-3-[(2-methylpyrazol-3-yl)sulfonylamino]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 113483146 |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-methyl-3-[(2-methylpyrazol-3-yl)sulfonylamino]-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(NS(=O)(=O)c2ccnn2C)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C10H12N4O4S/c1-6-5-7(9(12-6)10(15)16)13-19(17,18)8-3-4-11-14(8)2/h3-5,12-13H,1-2H3,(H,15,16) |
| InChIKey | KNFKZXJWNYWXFH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |