C12H14N4O4S — CID 104709410
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpyrazole-3-sulfonamide (PubChem CID 104709410) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104709410 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)Nc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C12H14N4O4S/c1-16-12(2-3-14-16)21(17,18)15-9-7-11-10(6-8(9)13)19-4-5-20-11/h2-3,6-7,15H,4-5,13H2,1H3 |
| InChIKey | UKBHBRQPJQTINX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|