C12H11BrN2O4S2 — CID 61457929
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-3-bromothiophene-2-sulfonamide (PubChem CID 61457929) has the molecular formula C12H11BrN2O4S2 and a molecular weight of 391.27 g/mol. Its IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-3-bromothiophene-2-sulfonamide.
| Compound Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-3-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61457929 |
| Molecular Formula | C12H11BrN2O4S2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-3-bromothiophene-2-sulfonamide |
| SMILES | Nc1cc2c(cc1NS(=O)(=O)c1sccc1Br)OCCO2 |
| InChI | InChI=1S/C12H11BrN2O4S2/c13-7-1-4-20-12(7)21(16,17)15-9-6-11-10(5-8(9)14)18-2-3-19-11/h1,4-6,15H,2-3,14H2 |
| InChIKey | DGUMJYKBZAUDIL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|