C14H14N2O4S — CID 43550629
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)benzenesulfonamide (PubChem CID 43550629) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)benzenesulfonamide.
| Compound Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43550629 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)benzenesulfonamide |
| SMILES | Nc1cc2c(cc1NS(=O)(=O)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C14H14N2O4S/c15-11-8-13-14(20-7-6-19-13)9-12(11)16-21(17,18)10-4-2-1-3-5-10/h1-5,8-9,16H,6-7,15H2 |
| InChIKey | PUSWXWVVXDHXMJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|