C7H12N4O4S — CID 114805356
5-(ethylsulfamoylamino)-1-methylpyrazole-4-carboxylic acid (PubChem CID 114805356) has the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 5-(ethylsulfamoylamino)-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-(ethylsulfamoylamino)-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114805356 |
| Molecular Formula | C7H12N4O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-(ethylsulfamoylamino)-1-methylpyrazole-4-carboxylic acid |
| SMILES | CCNS(=O)(=O)Nc1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C7H12N4O4S/c1-3-9-16(14,15)10-6-5(7(12)13)4-8-11(6)2/h4,9-10H,3H2,1-2H3,(H,12,13) |
| InChIKey | WRXALWOTTXEPME-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |