C8H11N3O3 — CID 110477561
1-methyl-5-(propanoylamino)pyrazole-4-carboxylic acid (PubChem CID 110477561) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 1-methyl-5-(propanoylamino)pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-5-(propanoylamino)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 110477561 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 1-methyl-5-(propanoylamino)pyrazole-4-carboxylic acid |
| SMILES | CCC(=O)Nc1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C8H11N3O3/c1-3-6(12)10-7-5(8(13)14)4-9-11(7)2/h4H,3H2,1-2H3,(H,10,12)(H,13,14) |
| InChIKey | OANPTPNIZAGYAY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |