C7H11ClN2O2 — CID 54594161
5-ethyl-1-methylpyrazole-4-carboxylic acid;hydrochloride (PubChem CID 54594161) has the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. Its IUPAC name is 5-ethyl-1-methylpyrazole-4-carboxylic acid;hydrochloride.
| Compound Name | 5-ethyl-1-methylpyrazole-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 54594161 |
| Molecular Formula | C7H11ClN2O2 |
| Molecular Weight | 190.63 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 5-ethyl-1-methylpyrazole-4-carboxylic acid;hydrochloride |
| SMILES | CCc1c(C(=O)O)cnn1C.Cl |
| InChI | InChI=1S/C7H10N2O2.ClH/c1-3-6-5(7(10)11)4-8-9(6)2;/h4H,3H2,1-2H3,(H,10,11);1H |
| InChIKey | HVDWKKOIAGJTGL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.63 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |