C6H10ClN3O2 — CID 75468759
5-(aminomethyl)-1-methylpyrazole-4-carboxylic acid;hydrochloride (PubChem CID 75468759) has the molecular formula C6H10ClN3O2 and a molecular weight of 191.62 g/mol. Its IUPAC name is 5-(aminomethyl)-1-methylpyrazole-4-carboxylic acid;hydrochloride.
| Compound Name | 5-(aminomethyl)-1-methylpyrazole-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 75468759 |
| Molecular Formula | C6H10ClN3O2 |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 5-(aminomethyl)-1-methylpyrazole-4-carboxylic acid;hydrochloride |
| SMILES | Cl.Cn1ncc(C(=O)O)c1CN |
| InChI | InChI=1S/C6H9N3O2.ClH/c1-9-5(2-7)4(3-8-9)6(10)11;/h3H,2,7H2,1H3,(H,10,11);1H |
| InChIKey | FYOPCMJIIRXSJC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |