C10H12N4O2 — CID 116630240
1-methyl-5-[(4-methylpyrazol-1-yl)methyl]pyrazole-4-carboxylic acid (PubChem CID 116630240) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-methyl-5-[(4-methylpyrazol-1-yl)methyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-5-[(4-methylpyrazol-1-yl)methyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116630240 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-methyl-5-[(4-methylpyrazol-1-yl)methyl]pyrazole-4-carboxylic acid |
| SMILES | Cc1cnn(Cc2c(C(=O)O)cnn2C)c1 |
| InChI | InChI=1S/C10H12N4O2/c1-7-3-12-14(5-7)6-9-8(10(15)16)4-11-13(9)2/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | UNWPNGUZRPGUCU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |