C10H10N2O3 — CID 60873102
2-[(4-methylpyrazol-1-yl)methyl]furan-3-carboxylic acid (PubChem CID 60873102) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-[(4-methylpyrazol-1-yl)methyl]furan-3-carboxylic acid.
| Compound Name | 2-[(4-methylpyrazol-1-yl)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 60873102 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-[(4-methylpyrazol-1-yl)methyl]furan-3-carboxylic acid |
| SMILES | Cc1cnn(Cc2occc2C(=O)O)c1 |
| InChI | InChI=1S/C10H10N2O3/c1-7-4-11-12(5-7)6-9-8(10(13)14)2-3-15-9/h2-5H,6H2,1H3,(H,13,14) |
| InChIKey | WJSSKRWXFIXZKZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |