C7H13ClN4O — CID 130616096
5-ethyl-1-methylpyrazole-4-carbohydrazide;hydrochloride (PubChem CID 130616096) has the molecular formula C7H13ClN4O and a molecular weight of 204.66 g/mol. Its IUPAC name is 5-ethyl-1-methylpyrazole-4-carbohydrazide;hydrochloride.
| Compound Name | 5-ethyl-1-methylpyrazole-4-carbohydrazide;hydrochloride |
|---|---|
| PubChem CID | 130616096 |
| Molecular Formula | C7H13ClN4O |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 5-ethyl-1-methylpyrazole-4-carbohydrazide;hydrochloride |
| SMILES | CCc1c(C(=O)NN)cnn1C.Cl |
| InChI | InChI=1S/C7H12N4O.ClH/c1-3-6-5(7(12)10-8)4-9-11(6)2;/h4H,3,8H2,1-2H3,(H,10,12);1H |
| InChIKey | CEYLZPMTXSGNIY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|