C11H18N2O4 — CID 116629771
1-methyl-5-(2-propoxyethoxymethyl)pyrazole-4-carboxylic acid (PubChem CID 116629771) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-methyl-5-(2-propoxyethoxymethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-5-(2-propoxyethoxymethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116629771 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-methyl-5-(2-propoxyethoxymethyl)pyrazole-4-carboxylic acid |
| SMILES | CCCOCCOCc1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C11H18N2O4/c1-3-4-16-5-6-17-8-10-9(11(14)15)7-12-13(10)2/h7H,3-6,8H2,1-2H3,(H,14,15) |
| InChIKey | QSCKJGYWMCHVKV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|