C8H10ClN3O3 — CID 110480863
5-(3-chloropropanoylamino)-1-methylpyrazole-4-carboxylic acid (PubChem CID 110480863) has the molecular formula C8H10ClN3O3 and a molecular weight of 231.64 g/mol. Its IUPAC name is 5-(3-chloropropanoylamino)-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-(3-chloropropanoylamino)-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 110480863 |
| Molecular Formula | C8H10ClN3O3 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 5-(3-chloropropanoylamino)-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1NC(=O)CCCl |
| InChI | InChI=1S/C8H10ClN3O3/c1-12-7(11-6(13)2-3-9)5(4-10-12)8(14)15/h4H,2-3H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | VMZQOAOXUUESDK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|