C8H13N3O3 — CID 69159232
5-(2-hydroxypropylamino)-1-methylpyrazole-4-carboxylic acid (PubChem CID 69159232) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-(2-hydroxypropylamino)-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-(2-hydroxypropylamino)-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 69159232 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 5-(2-hydroxypropylamino)-1-methylpyrazole-4-carboxylic acid |
| SMILES | CC(O)CNc1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C8H13N3O3/c1-5(12)3-9-7-6(8(13)14)4-10-11(7)2/h4-5,9,12H,3H2,1-2H3,(H,13,14) |
| InChIKey | MOPIOMVLVLQCCH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |