C13H14N4O2 — CID 110472119
1-methyl-5-[(2-phenylacetyl)amino]pyrazole-4-carboxamide (PubChem CID 110472119) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-methyl-5-[(2-phenylacetyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-5-[(2-phenylacetyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 110472119 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 1-methyl-5-[(2-phenylacetyl)amino]pyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(N)=O)c1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H14N4O2/c1-17-13(10(8-15-17)12(14)19)16-11(18)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,14,19)(H,16,18) |
| InChIKey | YFJAVGNIRQMUIK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |