C7H10F3N5O2S2 — CID 114808481
1-methyl-5-(2,2,2-trifluoroethylsulfamoylamino)pyrazole-4-carbothioamide (PubChem CID 114808481) has the molecular formula C7H10F3N5O2S2 and a molecular weight of 317.32 g/mol. Its IUPAC name is 1-methyl-5-(2,2,2-trifluoroethylsulfamoylamino)pyrazole-4-carbothioamide.
| Compound Name | 1-methyl-5-(2,2,2-trifluoroethylsulfamoylamino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 114808481 |
| Molecular Formula | C7H10F3N5O2S2 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 1-methyl-5-(2,2,2-trifluoroethylsulfamoylamino)pyrazole-4-carbothioamide |
| SMILES | Cn1ncc(C(N)=S)c1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H10F3N5O2S2/c1-15-6(4(2-12-15)5(11)18)14-19(16,17)13-3-7(8,9)10/h2,13-14H,3H2,1H3,(H2,11,18) |
| InChIKey | PTISRIGVGPQVAV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|