About ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate
ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate (PubChem CID 136827551) has the molecular formula C8H14N6O5S
and a molecular weight of 306.30 g/mol. Its IUPAC name is ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate |
| PubChem CID | 136827551 |
| Molecular Formula | C8H14N6O5S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1c(C(N)=NO)cnn1C |
| InChI | InChI=1S/C8H14N6O5S/c1-3-19-8(15)13-20(17,18)12-7-5(6(9)11-16)4-10-14(7)2/h4,12,16H,3H2,1-2H3,(H2,9,11)(H,13,15) |
| InChIKey | FFYMTLNGPMIRCM-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate?
The IUPAC name of ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate (CID 136827551) is ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate.
What is the SMILES notation for ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate?
The canonical SMILES for ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate is CCOC(=O)NS(=O)(=O)Nc1c(C(N)=NO)cnn1C.
What is the InChIKey of ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate?
The InChIKey is FFYMTLNGPMIRCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N6O5S/c1-3-19-8(15)13-20(17,18)12-7-5(6(9)11-16)4-10-14(7)2/h4,12,16H,3H2,1-2H3,(H2,9,11)(H,13,15).
What are the key properties of ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate?
ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate has a molecular weight of 306.30 g/mol, XLogP of -1.08, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate is sourced from PubChem (CID 136827551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).