C8H14N6O5S — CID 136827551
ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate (PubChem CID 136827551) has the molecular formula C8H14N6O5S and a molecular weight of 306.30 g/mol. Its IUPAC name is ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate.
| Compound Name | ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 136827551 |
| Molecular Formula | C8H14N6O5S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | ethyl N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrazol-5-yl]sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1c(C(N)=NO)cnn1C |
| InChI | InChI=1S/C8H14N6O5S/c1-3-19-8(15)13-20(17,18)12-7-5(6(9)11-16)4-10-14(7)2/h4,12,16H,3H2,1-2H3,(H2,9,11)(H,13,15) |
| InChIKey | FFYMTLNGPMIRCM-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|