C10H16N6O2 — CID 137277541
N-[4-[(E)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]pyrrolidine-1-carboxamide (PubChem CID 137277541) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is N-[4-[(E)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[4-[(E)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 137277541 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N-[4-[(E)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]pyrrolidine-1-carboxamide |
| SMILES | Cn1ncc(/C(N)=N\O)c1NC(=O)N1CCCC1 |
| InChI | InChI=1S/C10H16N6O2/c1-15-9(7(6-12-15)8(11)14-18)13-10(17)16-4-2-3-5-16/h6,18H,2-5H2,1H3,(H2,11,14)(H,13,17) |
| InChIKey | KMSFJVCKPBKTNK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|