C10H10ClN5O3 — CID 136690600
5-chloro-N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]furan-2-carboxamide (PubChem CID 136690600) has the molecular formula C10H10ClN5O3 and a molecular weight of 283.68 g/mol. Its IUPAC name is 5-chloro-N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 136690600 |
| Molecular Formula | C10H10ClN5O3 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 5-chloro-N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]furan-2-carboxamide |
| SMILES | Cn1ncc(/C(N)=N/O)c1NC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C10H10ClN5O3/c1-16-9(5(4-13-16)8(12)15-18)14-10(17)6-2-3-7(11)19-6/h2-4,18H,1H3,(H2,12,15)(H,14,17) |
| InChIKey | DVJRRTFBWQPDGQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|