About 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide
5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide (PubChem CID 107469649) has the molecular formula C13H12ClN3O4
and a molecular weight of 309.71 g/mol. Its IUPAC name is 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide |
| PubChem CID | 107469649 |
| Molecular Formula | C13H12ClN3O4 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide |
| SMILES | COc1cccc(/C(N)=N/O)c1NC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C13H12ClN3O4/c1-20-8-4-2-3-7(12(15)17-19)11(8)16-13(18)9-5-6-10(14)21-9/h2-6,19H,1H3,(H2,15,17)(H,16,18) |
| InChIKey | WDIOFLYJOSXVSP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide?
The IUPAC name of 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide (CID 107469649) is 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide.
What is the SMILES notation for 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide?
The canonical SMILES for 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide is COc1cccc(/C(N)=N/O)c1NC(=O)c1ccc(Cl)o1.
What is the InChIKey of 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide?
The InChIKey is WDIOFLYJOSXVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3O4/c1-20-8-4-2-3-7(12(15)17-19)11(8)16-13(18)9-5-6-10(14)21-9/h2-6,19H,1H3,(H2,15,17)(H,16,18).
What are the key properties of 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide?
5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide has a molecular weight of 309.71 g/mol, XLogP of 2.29, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]furan-2-carboxamide is sourced from PubChem (CID 107469649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).