C11H13F3N4O3 — CID 107469760
1-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 107469760) has the molecular formula C11H13F3N4O3 and a molecular weight of 306.24 g/mol. Its IUPAC name is 1-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 107469760 |
| Molecular Formula | C11H13F3N4O3 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-methoxyphenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COc1cccc(/C(N)=N/O)c1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N4O3/c1-21-7-4-2-3-6(9(15)18-20)8(7)17-10(19)16-5-11(12,13)14/h2-4,20H,5H2,1H3,(H2,15,18)(H2,16,17,19) |
| InChIKey | UAQSZNCDGPABNW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|