C12H11Br2N5O2 — CID 136704074
3,5-dibromo-N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]benzamide (PubChem CID 136704074) has the molecular formula C12H11Br2N5O2 and a molecular weight of 417.06 g/mol. Its IUPAC name is 3,5-dibromo-N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]benzamide.
| Compound Name | 3,5-dibromo-N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 136704074 |
| Molecular Formula | C12H11Br2N5O2 |
| Molecular Weight | 417.06 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | 3,5-dibromo-N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1-methylpyrazol-5-yl]benzamide |
| SMILES | Cn1ncc(/C(N)=N/O)c1NC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H11Br2N5O2/c1-19-11(9(5-16-19)10(15)18-21)17-12(20)6-2-7(13)4-8(14)3-6/h2-5,21H,1H3,(H2,15,18)(H,17,20) |
| InChIKey | BUWUNYXQWNXWEX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.06 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|