C12H10BrClN4OS — CID 107999079
3-bromo-N-(4-carbamothioyl-1-methylpyrazol-5-yl)-4-chlorobenzamide (PubChem CID 107999079) has the molecular formula C12H10BrClN4OS and a molecular weight of 373.66 g/mol. Its IUPAC name is 3-bromo-N-(4-carbamothioyl-1-methylpyrazol-5-yl)-4-chlorobenzamide.
| Compound Name | 3-bromo-N-(4-carbamothioyl-1-methylpyrazol-5-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 107999079 |
| Molecular Formula | C12H10BrClN4OS |
| Molecular Weight | 373.66 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 3-bromo-N-(4-carbamothioyl-1-methylpyrazol-5-yl)-4-chlorobenzamide |
| SMILES | Cn1ncc(C(N)=S)c1NC(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H10BrClN4OS/c1-18-11(7(5-16-18)10(15)20)17-12(19)6-2-3-9(14)8(13)4-6/h2-5H,1H3,(H2,15,20)(H,17,19) |
| InChIKey | PMTSTNIZSMVXFS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.66 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|