C9H9N5OS2 — CID 79500369
N-(4-carbamothioyl-1-methylpyrazol-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 79500369) has the molecular formula C9H9N5OS2 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-(4-carbamothioyl-1-methylpyrazol-5-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-carbamothioyl-1-methylpyrazol-5-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 79500369 |
| Molecular Formula | C9H9N5OS2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | N-(4-carbamothioyl-1-methylpyrazol-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cn1ncc(C(N)=S)c1NC(=O)c1cscn1 |
| InChI | InChI=1S/C9H9N5OS2/c1-14-8(5(2-12-14)7(10)16)13-9(15)6-3-17-4-11-6/h2-4H,1H3,(H2,10,16)(H,13,15) |
| InChIKey | HTMMVICHWMQFJE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|